Fosbretabulin disodium is the disodium salt of a water-soluble phosphate derivative of a natural stilbenoid phenol derived from the African bush willow (Combretum caffrum). It functions as a prodrug that is dephosphorylated to the active metabolite combretastatin A4, a microtubule-depolymerizing agent that disrupts tumor vasculature, leading to reduced blood flow and ischemic necrosis in tumor tissue.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 168555-66-6
Conivaptan hydrochloride
Vasopressin receptor antagonist
(R)-5-(AZIDOMETHYL)-3-[3-FLUORO-4-(4-MORPHOLINYL)PHENYL]-2-OXAZOLIDINONE
antibiotic impurity reference standard
(5S)-5-(Aminomethyl)-3-[3-fluoro-4-(4-morpholinyl)phenyl]-2-oxazolidinone
active pharmaceutical ingredient impurity
TAS-115 mesylate
active pharmaceutical ingredient
disodium;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate
VXNQMUVMEIGUJW-XNOMRPDFSA-L
COC1=C(C=C(C=C1)/C=C\C2=CC(=C(C(=C2)OC)OC)OC)OP(=O)([O-])[O-].[Na+].[Na+]