This compound is a pharmaceutical intermediate characterized by a molecular structure containing aromatic rings, ether linkages, an alcohol group, and a heterocyclic pyrimidinedione core. Its primary significance lies in its use as a building block in the manufacturing of pharmaceutical products.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 168332-14-7
2'-O-(2-Methoxyethyl)adenosine
pharmaceutical intermediate
(3R)-1-benzylpiperidin-3-amine
pharmaceutical intermediate
(S)-3-Amino-1-benzylpiperidine
pharmaceutical intermediate
Tetrahydro-2-furancarboxylic acid
pharmaceutical intermediate
(S)-DMT-glycidol-T
pharmaceutical intermediate for oligonucleotide synthesis
(S)-GNA-T-phosphoramidite
Pharmaceutical intermediate for GNA synthesis
(S)-GNA-U-phosphoramidite
Phosphoramidite building block for oligonucleotide synthesis
1-[(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-5-methylpyrimidine-2,4-dione
IUULEBAFSFROKM-XMMPIXPASA-N
CC1=CN(C(=O)NC1=O)C[C@H](COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)O