4-Methyl-3,5-dinitrobenzoic acid is a chemical compound used primarily as an intermediate in organic synthesis. It features a benzoic acid core substituted with methyl and nitro groups, contributing to its reactivity in further chemical transformations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 16533-71-4
Disodium 1,5-naphthalenedisulfonate
anti-scaling and corrosion inhibitor
Disodium 2,7-naphthalenedisulfonate
naphthalene sulfonate intermediate for dyes
SODIUM OLEATE
Emulsifier and ore flotation agent
2-Methoxyethyl vinyl ether
Industrial polymer production
4-methyl-3,5-dinitrobenzoic acid
LZWWZQXBKVZKIP-UHFFFAOYSA-N
CC1=C(C=C(C=C1[N+](=O)[O-])C(=O)O)[N+](=O)[O-]