This compound is a protected uridine phosphoramidite derivative used as a building block in the solid-phase synthesis of oligonucleotides. Its structure incorporates a 2'-O-(2-methoxyethyl) modification, a 5'-O-dimethoxytrityl protecting group, and a 3'-O-(diisopropylamino-2-cyanoethoxyphosphanyl) group, making it suitable for automated RNA synthesis in research and pharmaceutical manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 163759-97-5
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-propyl-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite] (9CI)
RNA synthesis building block
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-methyl-, 3'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite]
RNA synthesis phosphoramidite building block
2'-propargyl U amidite
RNA synthesis phosphoramidite building block
2'-O-Hexadecyl-U-CE-Phosphoramidite
nucleoside phosphoramidite for oligonucleotide synthesis
(R)-1-Boc-3-methylpiperazine
pharmaceutical intermediate
(S)-2,4,5-Trifluoro-N-(1,1,1-trifluoropropan-2-yl)benzamide
Pharmaceutical intermediate
2-Ethoxy-1,3-benzodioxole-5-carboxaldehyde
pharmaceutical intermediate
(S)-N-Benzyl-1-(1-naphthyl)ethylamine hydrochloride
pharmaceutical intermediate
3-[[(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)-4-(2-methoxyethoxy)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile
ZLOKLUONKGURQI-UAQIPLLRSA-N
CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1[C@H](O[C@H]([C@@H]1OCCOC)N2C=CC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC