This compound is a protected amino acid derivative used in peptide synthesis. It features a fluorenylmethoxycarbonyl (Fmoc) protecting group on the amino terminus and a tert-butoxycarbonyl (Boc) group on the indole nitrogen, enabling selective deprotection during solid-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 163619-04-3
Fmoc-Trp(N-CH2-COOtBu)-OH
research compound
Boc-Trp(Boc)-OH
Protected amino acid building block
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(1-methyl-1H-indol-3-yl)propanoic acid
Building block for peptide synthesis
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-((2-(methylthio)ethyl)amino)-2-((3,3,3-trifluoropropyl)thio)-9H-purin-9-yl)tetrahydrofuran-3,4-diol
Pharmaceutical intermediate
Tributylamine (dichloromethylene)bis(phosphonate)
pharmaceutical intermediate
Afatinib Impurity I
pharmaceutical reference standard
2'-Deoxyadenosine monohydrate
pharmaceutical intermediate
Fmoc-L-Trp(Boc)-OH
protected amino acid building block
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid
ADOHASQZJSJZBT-AREMUKBSSA-N
CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35