EEDQ is a research reagent commonly used as a peptide coupling reagent in laboratory peptide synthesis. It facilitates the formation of amide bonds by activating carboxylic acids.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 16357-59-8
Benzotriazol-1-yloxy-tris(dimethylamino)phosphonium hexafluorophosphate
peptide coupling reagent
Propylphosphonic anhydride
peptide coupling reagent
2-Hbtu
peptide coupling reagent
2-(2,5-Dioxopyrrolidin-1-yl)-1,1,3,3-tetramethylisouronium tetrafluoroborate
peptide coupling reagent
(S)-1-(Thiophen-3-yl)ethanamine
research compound
Cyclo(-Ala-Glu)
research compound
Trans-Zeatin
Plant cytokinin research reagent
(2R,3R,4S,5R)-2-(6-aMino-2-(3,3,3-trifluoropropylthio)-9H-purin-9-yl)-5-(hydroxyMethyl)tetrahydrofuran-3,4-diol
research compound
ethyl 2-ethoxy-2H-quinoline-1-carboxylate
GKQLYSROISKDLL-UHFFFAOYSA-N
CCOC1C=CC2=CC=CC=C2N1C(=O)OCC