Vilazodone Carboxylic acid is a chemical compound used as a pharmaceutical intermediate. Its structure features a benzofuran carboxylic acid moiety linked to a piperazine ring, which is further connected to a cyanoindolylbutyl group.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 163521-19-5
Vilazodone hydrochloride
antidepressant active pharmaceutical ingredient
Vilazodon
antidepressant active pharmaceutical ingredient
Ethyl 5-(piperazin-1-yl)benzofuran-2-carboxylate
Pharmaceutical intermediate for vilazodone synthesis
4-chloropyrimidine-5-carbonitrile
pharmaceutical intermediate
N-Isobutyryl-2',3'-Acetyl-Guanosine
pharmaceutical intermediate for nucleoside synthesis
1-(3-Phenylprop-2-en-1-yl)piperazine--hydrogen chloride (1/1)
Pharmaceutical intermediate
5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylic acid
RSXUEYFLDNUILS-UHFFFAOYSA-N
C1CN(CCN1CCCCC2=CNC3=C2C=C(C=C3)C#N)C4=CC5=C(C=C4)OC(=C5)C(=O)O