This compound is a pharmaceutical intermediate featuring a complex structure with multiple stereocenters, containing an alcohol, aromatic rings, ether groups, and a heterocycle. Its high molecular weight and lipophilicity, along with significant hydrogen bond donor and acceptor capacity, indicate a role in the synthesis of specialized organic molecules for pharmaceutical manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 162849-95-8
1-((3R,5r,8r,9r,10s,13s,14s,17s)-3-hydroxy-3,13-dimethylhexadecahydro-1h-cyclopenta[a]phenanthren-17-yl)ethanone
pharmaceutical intermediate
(alphaR,2R)-3,4-Dihydro-5-[(4-nitrophenyl)methyl]-alpha-phenyl-2H-pyrrole-2-methanol
pharmaceutical intermediate
Tert-butyl (R)-8-methyl-3-(3-methyl-1,2,4-thiadiazol-5-yl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-7(8H)-carboxylate
Pharmaceutical intermediate
4-(Piperidin-4-yl)benzonitrile--hydrogen chloride (1/1)
pharmaceutical intermediate
1,3-Thiazol-5-ylmethyl N-[(1S,2S,4S)-4-amino-1-benzyl-2-hydroxy-5-phenylpentyl]carbamate
pharmaceutical intermediate for protease inhibitors
tert-butyl N-[(2S,4S,5S)-4-hydroxy-1,6-diphenyl-5-(1,3-thiazol-5-ylmethoxycarbonylamino)hexan-2-yl]carbamate
NURNDOWJCSUXHT-HVCNVCAESA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C[C@@H]([C@H](CC2=CC=CC=C2)NC(=O)OCC3=CN=CS3)O