1,2,3,4,5-Pentadeuterio-6-methylbenzene is a deuterated analytical standard that serves as an isotopically labeled reference compound for quantitative analysis. Its structure features a methyl-substituted aromatic ring where five hydrogen atoms are replaced by deuterium, making it valuable for mass spectrometry and nuclear magnetic resonance spectroscopy calibration.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1603-99-2
2-HEPTANONE-1,1,1,3,3-D5
deuterated analytical standard
Trans-Cinnamic-d7 acid
deuterated analytical standard
Dimethyl succinate-d4
deuterated analytical standard
(2H10)Cyclohexanone
deuterated analytical standard
X-NeuNAc
Chromogenic substrate for neuraminidase assay
1-(1-bromoethyl)-3,5-bis(trifluoromethyl)benzene
Research reagent for organic synthesis
Hepps
buffer reagent
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-propyl-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite] (9CI)
RNA synthesis building block
1,2,3,4,5-pentadeuterio-6-methylbenzene
YXFVVABEGXRONW-VIQYUKPQSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C)[2H])[2H]