1-Methyladenosine is a methylated nucleoside derived from adenosine, where a methyl group is attached to the nitrogen at position 1 of the adenine base. It is a naturally occurring human metabolite and is commonly used as a research compound in biochemical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 15763-06-1
Adenosine-(1)N N1-Oxide
research compound
3,4-Difluoro-2-methylbenzoic acid
research compound
Progesterone-2,2,4,6,6,17alpha,21,21,21-d9
deuterated internal standard for mass spectrometry
Mal-C6-|A-Amanitin
Research compound for targeted delivery
(2,2'-Bipyridyl)bis[2-(4-fluorophenyl)pyridine]iridium(III) hexafluorophosphate
organometallic research compound
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-imino-1-methylpurin-9-yl)oxolane-3,4-diol
GFYLSDSUCHVORB-IOSLPCCCSA-N
CN1C=NC2=C(C1=N)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O