This compound is a pharmaceutical intermediate specifically used in the synthesis of eribulin, a complex macrocyclic ether known for its anticancer activity. It features a tetrahydrofuran ring with an attached iodinated alkene side chain and a pivalate ester group.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 157322-47-9
Eribulin mesylate intermediate
Eribulin mesylate synthetic intermediate
1-BOC-3-[(DIMETHYLAMINO)METHYLENE]-4-OXOPIPERIDINE
Pharmaceutical intermediate
2'-dG(iBu)-2'-phosphoramidite
Phosphoramidite reagent for oligonucleotide synthesis
5-Chlorovaleryl chloride
Pharmaceutical intermediate
3-((2S,5S)-5-(3-hydroxypropyl)-4-methylenetetrahydrofuran-2-yl)propyl pivalate
pharmaceutical intermediate
3-((2S,5S)-5-((3R,5R)-5-Methyl-3-((methylsulfonyl)oxy)-6-(((trifluoromethyl)sulfonyl)oxy)hept-6-en-1-yl)-4-methylenetetrahydrofuran-2-yl)propyl pivalate
pharmaceutical intermediate
3-[5-(3-hydroxy-6-iodo-5-methylhept-6-enyl)-4-methylideneoxolan-2-yl]propyl 2,2-dimethylpropanoate
BATPHVGPKRJKIK-UHFFFAOYSA-N
CC(CC(CCC1C(=C)CC(O1)CCCOC(=O)C(C)(C)C)O)C(=C)I