This compound is a highly substituted octahydrocorrin derivative containing three nitrophenyl groups, characterized by a complex polycyclic structure with multiple stereocenters and a high molecular weight. Its structural features include multiple aromatic rings and heterocycles, and the presence of both donor and acceptor groups suggests potential electronic or optical properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1570275-52-3
8,14-dimethyl-5,10,15-tris(4-nitrophenyl)-1,2,7,8,13,21,22,23-octahydrocorrin
ZBGTYBGGNQXSDZ-UHFFFAOYSA-N
CC1CC2=C(C3=CCC(N3)C4=NC(=C(C5(CC=C(N5)C(=C1N2)C6=CC=C(C=C6)[N+](=O)[O-])C)C7=CC=C(C=C7)[N+](=O)[O-])C=C4)C8=CC=C(C=C8)[N+](=O)[O-]
—