Heptanoic-7,7,7-d3 acid is a deuterium-labeled analytical reference standard, specifically the This compound isotopologue. It is primarily used in research and laboratory settings as a stable isotope internal standard for quantitative analysis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 156779-04-3
Heptadecanoic acid-d3
deuterated fatty acid reference standard
Tetradecanoic-14,14,14-d3 acid
isotopically labeled fatty acid standard
Decanoic-10,10,10-d3 acid
deuterated fatty acid research standard
Nonanoic acid-d3
deuterated fatty acid reference standard
Sodium borodeuteride
deuterated reducing agent
1,8-NAPHTHYRIDINE, 2-METHYL-
chemical research compound
4,4-dimethyl-2-oxotetrahydrofuran-3-yl methacrylate
research compound
(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate
Fmoc-protected aminoacetaldehyde reagent
7,7,7-trideuterioheptanoic acid
MNWFXJYAOYHMED-FIBGUPNXSA-N
[2H]C([2H])([2H])CCCCCC(=O)O