9-Bromoanthracene is a brominated aromatic compound used as a research reagent in organic synthesis. Its structure consists of an anthracene core with a bromine substituent, making it a useful building block for constructing more complex molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1564-64-3
3-Pyridinecarboxylic acid, 6-formyl-1,2-dihydro-2-oxo-
research compound
(4-Butoxy-2,3-difluorophenyl)boronic acid
Research intermediate for organic synthesis
Diethyl 2,6-pyridinedicarboxylate
research compound for crystallography
Pheophorbide a
research compound
9-bromoanthracene-d9
deuterated research reference standard
9,10-Dibromoanthracene
chemical reagent for synthesis
(2H10)Anthracene
deuterated internal standard
2,6-Dibromoanthracene
Research reagent for organic synthesis
9-bromoanthracene
ZIRVQSRSPDUEOJ-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=C3C=CC=CC3=C2Br