[(2-Aminoethoxy)methyl]tributylstannane is an organotin compound used as a synthetic intermediate in research laboratories. Its structure features a stannane center with a 2-aminoethoxy methyl group, making it valuable for organotin chemistry and specialty synthesis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1557288-04-6
1H-Indazol-5-ol
research compound
(5S)-5-Methyl-2-Pyrrolidinone
research compound
2-(3,4-Difluoro-2-methoxyphenyl)acetic acid
research compound
(3AS,4S,7R,7AS)-6-BENZYL-2,2-DIMETHYLTETRAHYDRO-4H-4,7-METHANO[1,3]DIOXOLO[4,5-D][1,2]OXAZINE
Reference standard for ticagrelor impurity
2-(tributylstannylmethoxy)ethanamine
YFZRXKFYLGAQOC-UHFFFAOYSA-N
CCCC[Sn](CCCC)(CCCC)COCCN