Diethylhexyl Butamido Triazone is a chemical compound used as a UV absorber in sunscreen formulations. It is characterized by a complex structure containing multiple aromatic rings and functional groups that contribute to its ultraviolet light absorption properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 154702-15-5
Ethylhexyl triazone
UVB sunscreen absorber
1-Benzylquinolinium chloride
Quaternary ammonium compound
Methyl 5-((2,4-difluorobenzyl)carbamoyl)-1-(2,2-dimethoxyethyl)-3-methoxy-4-oxo-1,4-dihydropyridine-2-carboxylate
research compound
Palmitoyl hexapeptide-12
cosmetic ingredient
Tetrabutylammonium hydrogencarbonate
phase transfer catalyst
2-ethylhexyl 4-[[4-[4-(tert-butylcarbamoyl)anilino]-6-[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate
OSCJHTSDLYVCQC-UHFFFAOYSA-N
CCCCC(CC)COC(=O)C1=CC=C(C=C1)NC2=NC(=NC(=N2)NC3=CC=C(C=C3)C(=O)NC(C)(C)C)NC4=CC=C(C=C4)C(=O)OCC(CC)CCCC