(5-Methoxypentyl)triphenylphosphonium Bromide is a phosphonium salt compound used primarily as a research reagent. Its structure features a triphenylphosphonium cation with a methoxypentyl side chain and a bromide counterion.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 154060-34-1
N-Butyldi(tert-butyl)phosphonium tetrafluoroborate
phosphonium salt research reagent
Di-tert-butyl(methyl)phosphonium tetrafluoroborate
phosphonium salt research reagent
Rh2[(S)-pttl]4
Dirhodium catalyst for asymmetric reactions
4-bromopyridine-3-carbaldehyde
research compound
Tetrakis(acetonitrile)copper(I) tetrafluoroborate
Copper(I) coordination chemistry reagent
Pentanedioic-d6 acid
deuterated analytical standard
(2-METHOXY-ETHYL)-TRIPHENYL-PHOSPHONIUM, BROMIDE
phosphonium salt reagent
Phosphonium, (methoxymethyl)triphenyl-, chloride
Wittig reagent for organic synthesis
5-methoxypentyl(triphenyl)phosphanium bromide
SHOUUNWCCLACFZ-UHFFFAOYSA-M
COCCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
—