Diclofenac Methyl Ester is a chemical compound that serves as a pharmaceutical intermediate, primarily used in the manufacturing of related active pharmaceutical ingredients. It features an ester functional group and aromatic rings, contributing to its role in synthetic chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 15307-78-5
Aceclofenac Methyl Ester
Pharmaceutical intermediate for aceclofenac synthesis
Diclofenac Ethyl Ester
active pharmaceutical ingredient
2,6-Dichloro-N-phenylaniline
Pharmaceutical intermediate
Tert-butyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]carbamate
Boc-protected amine PEG linker for synthesis
3((Dimethylamino)methyl)-1,2,3,9-tetrahydro-9-methyl-4H-carbazol-4-one
pharmaceutical intermediate
1,2-O-(1-methylethylidene)-4-C-[(phenylmethoxy)methyl]-3-O-(phenylmethyl)-L-Lyxofuranose
Pharmaceutical intermediate for nucleoside synthesis
methyl 2-[2-(2,6-dichloroanilino)phenyl]acetate
VETACGBDFVVKGZ-UHFFFAOYSA-N
COC(=O)CC1=CC=CC=C1NC2=C(C=CC=C2Cl)Cl