4-Hydroxybenzoic-2,3,5,6-d4 acid is a deuterated form of 4-hydroxybenzoic acid where all four aromatic hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in analytical chemistry to improve the accuracy of quantitative measurements.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 152404-47-2
Acenaphthylene D8
deuterated internal standard for analytical chemistry
Triruthenium dodecacarbonyl
organometallic research reagent
5-Bromo-6-methoxy-1H-indazole
research compound
Bis-PEG6-NHS ester
bifunctional crosslinking reagent
5-bromo-2-methoxy-3-nitropyridine
research compound
Potassium 4-hydroxybenzoate
preservative in cosmetics and food
4-HYDROXYBENZOIC ACID
intermediate for food preservatives
2,3,5,6-tetradeuterio-4-hydroxybenzoic acid
FJKROLUGYXJWQN-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])O)[2H]