Beta-Aminobenzenebutanoic acid is a pharmaceutical intermediate used in the synthesis of peptides and other active pharmaceutical ingredients. It features a beta-amino acid structure with an aromatic ring, contributing to its role as a building block in medicinal chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 15099-85-1
(2S)-2-amino-2-methyl-3-sulfanylpropanoic acid hydrochloride
alpha-methyl cysteine derivative for synthesis
4-(difluoromethoxy)-3-hydroxybenzaldehyde
Pharmaceutical intermediate
3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzaldehyde
Roflumilast intermediate
4,5-Didehydro Brimonidine
pharmaceutical research intermediate
3-amino-4-phenylbutanoic acid
OFVBLKINTLPEGH-UHFFFAOYSA-N
C1=CC=C(C=C1)CC(CC(=O)O)N