This compound is a chemical intermediate used in the synthesis of bosentan, a pharmaceutical agent. It is a dichlorinated bipyrimidine derivative with a methoxyphenoxy substituent.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 150728-13-5
O1-tert-butyl O3-ethyl cis-4-hydroxypiperidine-1,3-dicarboxylate
pharmaceutical intermediate
2'-OMe-G(ibu) Phosphoramidite
RNA synthesis building block
Ethyl(4-((4-fluorobenzyl)amino)-2-nitrophenyl)carbamate
Pharmaceutical intermediate
(S)-2-methylpyrrolidine-2-carboxylic acid Hydrochloride
Pharmaceutical intermediate
4,6-dichloro-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidine
IZGOBGVYADHVKH-UHFFFAOYSA-N
COC1=CC=CC=C1OC2=C(N=C(N=C2Cl)C3=NC=CC=N3)Cl