4-(Chlorosulfonyl)phenyl 2,2-dimethylpropanoate is a research compound featuring an aromatic ring, an ester group, and a sulfonyl chloride moiety. Its structure includes a chlorine atom and a branched ester substituent, contributing to its polarity and moderate lipophilicity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 150374-99-5
2-Fluoro-6-methoxybenzylamine
research compound
(1,1,2,2-2H4)Ethane-1,2-(2H2)diol
deuterated NMR standard
(2Z)-[(4S)-4-Phenyl-4,5-dihydro-1,3-oxazol-2-yl][(4S)-4-phenyl-1,3-oxazolidin-2-ylidene]acetonitrile
research compound
1,1,2,2,3,4,5,6,7,8-decadeuterioacenaphthylene
Deuterated analytical reference standard
(4-chlorosulfonylphenyl) 2,2-dimethylpropanoate
BSRSTUAZWZWGRT-UHFFFAOYSA-N
CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)Cl