Arachidonyltrifluoromethane (AACOCF3) is a fatty acid derivative and an analog of arachidonic acid. It is primarily used as a research compound that inhibits phospholipase A2, an enzyme involved in lipid metabolism.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 149301-79-1
1-(4-Nitrophenethyl)-3-propylurea
urea derivative for research
Sodium 3-((3-(((2,4-dimethylphenyl)amino)carbonyl)-2-hydroxy-1-naphthyl)azo)-4-hydroxybenzenesulphonate
Colorimetric reagent for magnesium determination
Bis(1,1,1,5,5,5-hexafluoropentane-2,4-dionato-O,O')nickel
research reagent for synthesis
(3-propoxyphenyl)boronic Acid
research compound for organic synthesis
(6Z,9Z,12Z,15Z)-1,1,1-trifluorohenicosa-6,9,12,15-tetraen-2-one
PLWROONZUDKYKG-DOFZRALJSA-N
CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)C(F)(F)F