1-Fluoro-2-nitrobenzene is a chemical compound used as a pharmaceutical intermediate. It features a benzene ring substituted with a fluorine atom and a nitro group, and is commonly employed in the synthesis of other organic compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1493-27-2
Tert-butyl N-[(pyrrolidin-3-yl)methyl]carbamate
pharmaceutical intermediate
4-(4-Fluorobenzoyl)butyric Acid
Ezetimibe intermediate
N-(2-(2-Hydroxy-4-(methylsulfonamido)-5-phenoxyphenyl)-2-oxoethyl)formamide
Pharmaceutical intermediate
4-(4-Chlorobutyl)pyridine hydrochloride
pharmaceutical intermediate for API synthesis
1-fluoro-2-nitrobenzene
PWKNBLFSJAVFAB-UHFFFAOYSA-N
C1=CC=C(C(=C1)[N+](=O)[O-])F