Indole-2-carboxylic acid is an indolyl carboxylic acid used primarily as a research compound or assay reagent. Its structure features a carboxylic acid group attached to an indole ring, contributing to its utility in laboratory studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1477-50-5
Propionic-2,2-d2 acid-d
deuterated research reagent
Omega-conotoxin MVIIC
research compound
Copper(ii)hexafluor-2,4-pentanedionate
Coordination chemistry research reagent
Dichloro(1,10-phenanthroline)copper(II)
research compound
1H-indole-2-carboxylic acid
HCUARRIEZVDMPT-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=C(N2)C(=O)O