Sabutamol dimer is a chemical compound used as an impurity reference standard for albuterol (salbutamol). It consists of two albuterol-like units linked through an ether bridge, featuring multiple hydroxyl and amine functional groups.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 147663-30-7
4-(2-(tert-Butylamino)-1-hydroxyethyl)-2-(methoxymethyl)phenol
Beta-2 adrenergic receptor agonist
Palmitoyl Tripeptide-1
cosmetic anti-aging ingredient
Beta-D-glucosaminyl-(1->4)-beta-D-glucosamine
chitosan oligosaccharide building block
Tetraoctylammonium bromide
Phase transfer catalyst
N-Nitroso Clonidine
Nitrosamine impurity standard
4-[2-(tert-butylamino)-1-hydroxyethyl]-2-[[5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl]methoxymethyl]phenol
DOEYIHXSVMYOHZ-UHFFFAOYSA-N
CC(C)(C)NCC(C1=CC(=C(C=C1)O)COCC2=C(C=CC(=C2)C(CNC(C)(C)C)O)O)O