This compound is a research reagent characterized as an inhibitor of the SARS-CoV 3CL protease. Its structure features multiple amide groups, aromatic rings, and a heterocyclic system, reflecting its intended application in antiviral compound studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1471484-62-4
2-Amino-3-(thiazol-4-yl)propanoic acid
research compound
N2-(4-(((2-Amino-4-oxo-4,8-dihydropteridin-6-yl)methyl)amino)benzoyl)-N5-(2-(2-(2-azidoethoxy)ethoxy)ethyl)-L-glutamine
PEGylated folate probe for click chemistry
2-Chloro-4-(naphthalen-1-yl)-6-phenyl-1,3,5-triazine
Research chemical for organic synthesis
Ethyl 2-(1H-1,3-benzodiazol-2-yl)acetate
research compound
N-[(2S)-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methoxy-1H-indole-2-carboxamide
JBLLRCOZJMVOAE-HSQYWUDLSA-N
CC(C)C[C@@H](C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C2=NC3=CC=CC=C3S2)NC(=O)C4=CC5=C(N4)C=CC=C5OC