1-Boc-D-Pyroglutamic acid ethyl ester is a chemical compound used as a pharmaceutical intermediate. It features a protected amino acid derivative structure with a tert-butoxycarbonyl (Boc) group and an ethyl ester, commonly employed in the synthesis of peptide-based compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 144978-35-8
1-tert-butyl 2-methyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
(S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-methoxy-4-oxobutanoic acid
Protected amino acid for peptide synthesis
T-Butyl (3S)-3-fluoro-4-oxopiperidine-1-carboxylate
pharmaceutical intermediate
((1R,2S)-2-(3-fluorophenyl)-2-((tosyloxy)methyl)cyclopropyl)methyl acetate
pharmaceutical intermediate
2-bromo-1-(4-methylphenyl)propan-1-one
pharmaceutical intermediate
1-(1,1-Dimethylethyl) 2-ethyl (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Pharmaceutical intermediate for peptide synthesis
1-O-tert-butyl 2-O-ethyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate
YWWWGFSJHCFVOW-MRVPVSSYSA-N
CCOC(=O)[C@H]1CCC(=O)N1C(=O)OC(C)(C)C