2-Propanone, 1-(triphenylphosphoranylidene)- is a research reagent primarily used as a Wittig reagent in organic synthesis. This compound facilitates the formation of carbon-carbon double bonds, making it valuable for constructing complex organic molecules in laboratory and manufacturing research settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1439-36-7
1-Cyclopropyl-2-(triphenylphosphoranylidene)-ethanone
Wittig reagent for organic synthesis
Phosphonium, (methoxymethyl)triphenyl-, chloride
Wittig reagent for organic synthesis
(2S)-2,6-diamino-N,N-diethylhexanamide
analytical reference standard
3-(Hydroxymethyl)pyrrolidin-3-ol hydrochloride
Research compound
4-Methylpyridine hydrochloride
research compound
2,4-Difluorophenylboronic acid
chemical intermediate for synthesis
Methyl (triphenylphosphoranylidene)acetate
Wittig reagent for organic synthesis
Tert-butyl (triphenylphosphoranylidene) acetate
phosphine reagent for Wittig reaction
1-(triphenyl-lambda5-phosphanylidene)propan-2-one
KAANTNXREIRLCT-UHFFFAOYSA-N
CC(=O)C=P(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3