Phenoxyacetic anhydride is a chemical compound used primarily as a research reagent. It consists of two phenoxyacetate groups linked by an anhydride bond, giving it a structure with aromatic rings and ether linkages.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 14316-61-1
3-Cyclopenten-1-one
Research reagent
5'-Deshydroxy 5'-Chloro L-Adenosine
research compound
N-(4-(5-Hydroxy-2,3,4,5-tetrahydro-1H-benzo[b]azepine-1-carbonyl)-3-methylphenyl)-2-methylbenzamide
research compound
(2H4)Urea
deuterated research reagent
(2-phenoxyacetyl) 2-phenoxyacetate
CCSBNBKMACZDGN-UHFFFAOYSA-N
C1=CC=C(C=C1)OCC(=O)OC(=O)COC2=CC=CC=C2