Copper(II) ethylacetoacetate is a copper coordination compound primarily used as a research reagent. It serves as a source of copper ions in synthetic and materials chemistry studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 14284-06-1
Rhodium(III) 2,4-pentanedionate
Research reagent and reference standard
Ruthenium(III) acetylacetonate
coordination chemistry research reagent
((5Alpha,6Alpha)-4,5-Epoxymorphinan-3,6-diol)
Certified reference standard
N4-Acetylcytidine triphosphate
Modified nucleotide triphosphate for research
copper bis(ethyl 3-oxobutanoate)
OXFZSJOUPRCPJO-UHFFFAOYSA-N
CCOC(=O)[CH-]C(=O)C.CCOC(=O)[CH-]C(=O)C.[Cu+2]