This compound is a synthetic peptide-like molecule with a complex polyamide structure, commonly supplied as a research reagent. It is characterized by multiple amide bonds and aromatic rings, resulting in high polarity and low lipophilicity, which are typical for laboratory-grade biochemical tools.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1426173-74-1
(S)-N-Nitroso Anatabine-d4
Nitrosamine reference standard
(4R)-4-tert-butyl-1,3-oxazolidin-2-one
chiral auxiliary for synthesis
5-methyl-2H-pyrazolo[3,4-b]pyridine
research compound
Tert-butyl N-[(piperidin-3-yl)methyl]carbamate
research compound
Goserelin acetate
active pharmaceutical ingredient
(Ser(tBu)6,Azagly10)-LHRH
LHRH peptide analog intermediate
Goserelin Impurity G
goserelin impurity reference standard
(D-Ser(tBu)6,D-Leu7,Azagly10)-LHRH
LHRH analog peptide
(2S)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2R)-1-[[(2R)-1-[[(2S)-1-[[(2S)-1-[(2S)-2-[(carbamoylamino)carbamoyl]pyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-5-oxopyrrolidine-2-carboxamide
BLCLNMBMMGCOAS-JRAHOCOPSA-N
CC(C)C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(=O)NNC(=O)N)NC(=O)[C@@H](COC(C)(C)C)NC(=O)[C@@H](CC2=CC=C(C=C2)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)[C@H](CC5=CN=CN5)NC(=O)[C@@H]6CCC(=O)N6