This compound is a difluorinated aromatic liquid crystal intermediate. It is primarily used in the manufacturing of liquid crystal materials for displays and optical devices.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 142400-92-8
Butyltrimethylammonium chloride
phase transfer catalyst
2-(2-Chloroethoxy)ethyl acetate
Chemical intermediate
Propanoic acid--2-ethoxyethan-1-ol (1/1)
Solvent and chemical intermediate
Methyl 6-chlorohexanoate
Chemical intermediate for synthesis
(trans(trans))-4'-vinyl-4-(4-methylphenyl)bicyclohexyl
liquid crystal intermediate
Trans,trans-4-(3,4-Difluorophenyl)-4'-propyl-1,1'-bi(cyclohexane)
liquid crystal intermediate
Benzene, 1-[(trans,trans)-4'-ethyl[1,1'-bicyclohexyl]-4-yl]-2,3-difluoro-4-methyl-
liquid crystal intermediate
(trans,trans)-4-(But-3-en-1-yl)-4'-(p-tolyl)-1,1'-bi(cyclohexane)
liquid crystal intermediate
4-[4-(4-ethenylcyclohexyl)cyclohexyl]-1,2-difluorobenzene
ALFLDQIYGBNZCO-UHFFFAOYSA-N
C=CC1CCC(CC1)C2CCC(CC2)C3=CC(=C(C=C3)F)F