3-(Trifluoromethyl)phenylboronic acid is a boronic acid derivative featuring an aromatic ring with a trifluoromethyl substituent. It is commonly employed as a research reagent in organic synthesis, particularly in cross-coupling reactions such as the Suzuki-Miyaura reaction, where it serves as a building block for constructing carbon-carbon bonds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1423-26-3
2-Trifluoromethylphenylboronic acid
research compound
4-Ethynylaniline
Research intermediate for supramolecular chemistry
4-Bromo-1,1'-biphenyl-d9
research reagent
4-bromopyridin-1-ium-1-olate
research compound
[3-(trifluoromethyl)phenyl]boronic acid
WOAORAPRPVIATR-UHFFFAOYSA-N
B(C1=CC(=CC=C1)C(F)(F)F)(O)O