This compound is a research reagent, specifically a protected amino acid derivative featuring a benzoic acid core with an N-methyl and tert-butoxycarbonyl (Boc) protecting group. Its significance lies in its use as a building block for peptide synthesis and other organic chemistry applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 141871-02-5
Methyl 1,4-dihydroxy-7-phenoxyisoquinoline-3-carboxylate
research compound
Methyl 1-chloro-4-hydroxy-7-phenoxyisoquinoline-3-carboxylate
research compound
2-Bromo-6-fluorotoluene
Research reagent for organic synthesis
Bis(benzonitrile)palladium chloride
coordination complex and catalyst precursor
2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid
UXLICAHPTWWCII-UHFFFAOYSA-N
CC(C)(C)OC(=O)N(C)C1=CC=CC=C1C(=O)O