This compound is a benzofuran derivative featuring a nitro group and a hydroxyphenyl ketone moiety. It is primarily used as a pharmaceutical intermediate in the synthesis of other chemical compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 141645-16-1
(2-Butyl-5-nitrobenzofuran-3-yl)(4-methoxyphenyl)methanone
research compound
(5-Bromo-3-(trifluoromethyl)pyridin-2-yl)methanamine hydrochloride
pharmaceutical synthetic intermediate
3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile
DNA synthesis phosphoramidite building block
Tert-butyl 3-hydroxyazetidine-1-carboxylate
protected building block for synthesis
Tert-Butyl 3-((methylsulfonyl)oxy)pyrrolidine-1-carboxylate
Pharmaceutical intermediate
(2-Butyl-5-nitrobenzofuran-3-yl)(4-(3-dibutylaminopropoxy)phenyl)methanone
active pharmaceutical ingredient
(2-Butylbenzofuran-3-yl) (4-hydroxyphenyl) ketone
pharmaceutical intermediate
1-Methoxy Amiodarone
pharmaceutical impurity reference standard
(2-butyl-5-nitro-1-benzofuran-3-yl)-(4-hydroxyphenyl)methanone
ZJZKLBXEGZKOBW-UHFFFAOYSA-N
CCCCC1=C(C2=C(O1)C=CC(=C2)[N+](=O)[O-])C(=O)C3=CC=C(C=C3)O