Mal-PEG4-PFP ester is a heterobifunctional crosslinking reagent featuring a maleimide group and a pentafluorophenyl ester linked by a hydrophilic polyethylene glycol (PEG) spacer. It is primarily used in bioconjugation chemistry for the modification of biomolecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1415800-42-8
Mal-PEG2-PFP ester
heterobifunctional crosslinking reagent
T-Boc-N-amido-PEG12-acid
PEG-based linker for bioconjugation
4,6-DICHLORO-2-METHYLPYRIMIDINE-5-CARBALDEHYDE
research compound
Ethyl (2S,5R)-5-((benzyloxy)amino)piperidine-2-carboxylate
Research compound
(2-Butyl-5-nitrobenzofuran-3-yl)(4-methoxyphenyl)methanone
research compound
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate
XGSVXFAIAZKWST-UHFFFAOYSA-N
C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F