3-O-tert-Butyldimethylsilyl Calcifediol is a synthetic derivative of calcifediol, a major vitamin D metabolite, modified with a tert-butyldimethylsilyl protecting group at the 3-position. It is primarily used as a research reagent for studying vitamin D metabolism and analytical chemistry applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 140710-90-3
Silane, (1,1-dimethylethyl)dimethyl[[(3beta,5E,7E)-9,10-secocholesta-5,7,10(19)-trien-3-yl]oxy]-
Vitamin D intermediate synthesis
(R)-6-((1R,3aS,7aR,E)-4-((Z)-2-((3S,5R)-3,5-bis(tert-butyldimethylsilyloxy)-2-methylenecyclohexylidene)ethylidene)-7a-methyloctahydro-1H-inden-1-yl)-2-methylheptan-2-ol
Research reagent
Calcifediol
active pharmaceutical ingredient
Calcifediol (monohydrate)
Active pharmaceutical ingredient
Dichloronickel;pyridine
research compound
Cis-4-(1,2,3,4-Tetrahydro-6-methoxy-2-phenyl-1-naphthalenyl)phenol
research compound
Magnesium, bromo-1-propenyl-
Grignard reagent for organic synthesis
Benzo-18-crown 6-Ether
crown ether for metal ion complexation
(6R)-6-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol
CTZMHDJIUFEYKE-NXMZLKDESA-N
C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O[Si](C)(C)C(C)(C)C)C