DBCO-Maleimide is a bifunctional compound that combines a dibenzocyclooctyne (DBCO) group for copper-free click chemistry with a maleimide group for thiol-specific conjugation. It is primarily used as a reagent for bioorthogonal labeling and bioconjugation without the need for cytotoxic copper catalysts.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1395786-30-7
Dibenzocyclooctyne-PEG4 maleimide
Copper-free click chemistry reagent
3,5-Dichloroisonicotinic acid
research compound
Ethyl 3-bromoisonicotinate
research compound
Dichlorobis(triphenylphosphine)palladium
catalyst for coupling reactions
2-CHLOROANISOLE-D3 (METHYL-D3)
deuterated research compound
N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]-3-(2,5-dioxopyrrol-1-yl)propanamide
NHFQNAGPXIVKND-UHFFFAOYSA-N
C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCNC(=O)CCN4C(=O)C=CC4=O