4-(Trifluoromethoxy)phenylboronic acid is a boronic acid derivative frequently employed as a research compound in organic synthesis. Its structure features an aromatic ring with a trifluoromethoxy substituent, contributing to its reactivity and utility in building complex molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 139301-27-2
4-Nitrophenylboronic acid
research compound for organic synthesis
2,3,4,5-Tetrafluorobenzoic acid
research compound for organic synthesis
4-(Trifluoromethyl)phenylboronic acid
research compound for organic synthesis
3-FORMYL-4-(TRIFLUOROMETHOXY)PHENYBORONIC ACID
research compound for organic synthesis
Tetraamminepalladium(II) chloride monohydrate
research compound for palladium chemistry
Azido-PEG2-PFP ester
bioconjugation crosslinking reagent
4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 2,5-dioxo-1-pyrrolidinyl ester
PEG-linked alkyne NHS ester crosslinker
(5-Chloro-3-(trifluoromethyl)pyridin-2-yl)methanamine
research reagent
[4-(trifluoromethoxy)phenyl]boronic acid
HUOFUOCSQCYFPW-UHFFFAOYSA-N
B(C1=CC=C(C=C1)OC(F)(F)F)(O)O
—