FMOC-CYS(ME)-OH is a research reagent consisting of a cysteine derivative protected with a fluorenylmethoxycarbonyl (Fmoc) group and methylated on the sulfur atom. It is primarily used in peptide synthesis as a building block for introducing S-methyl-L-cysteine residues.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 138021-87-1
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-methionine
Fmoc-protected amino acid for peptide synthesis
D-FMOC-methionine
Protected amino acid for peptide synthesis
Fmoc-S-tert-butyl-cys
side chain protected amino acid
Fmoc-cys (acm)
side-chain protected amino acid for peptide synthesis
2-isopropoxy-5-methyl-4-(piperidin-4-yl)aniline dihydrochloride
research compound
Magnesium bromide 2,4-dimethoxybenzen-1-ide (1/1/1)
Grignard reagent for organic synthesis
Sulfuric acid-d2
deuterated solvent and reagent
(S)-methyl 3-(pyrrolidin-2-yl)benzoate hydrochloride
research compound
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylsulfanylpropanoic acid
SKNJDZVHMNQAGO-KRWDZBQOSA-N
CSC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13