N-(tert-Butoxycarbonyl)-L-phenylalanine is a Boc-protected amino acid intermediate used in pharmaceutical manufacturing and research. It serves as a building block in peptide synthesis and other organic chemistry applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 13734-34-4
L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-
Protected amino acid for peptide synthesis
Boc-L-phenylalanine methyl ester
protected amino acid derivative
O-Benzyl-N-((tert-butoxy)carbonyl)-L-tyrosine
research compound for peptide synthesis
3-amino-2-{[(tert-butoxy)carbonyl]amino}propanoic acid
Boc-protected amino acid intermediate
(2R)-2-(tert-butoxycarbonylamino)-3-(2-methyl-4-pyridyl)propanoic acid
Boc-protected amino acid intermediate
3-tert-Butoxycarbonylamino-2-hydroxy-4-phenylbutyric acid
Boc-protected amino acid intermediate
N-Boc-(2S,3S)-3-amino-2-hydroxy-4-phenyl-butyric acid
Boc-protected amino acid intermediate
TERT-BUTYL 5-(AMINOMETHYL)-3,3-DIFLUOROPIPERIDINE-1-CARBOXYLATE
pharmaceutical intermediate for drug synthesis
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid
ZYJPUMXJBDHSIF-NSHDSACASA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O