Dipropyl pyridine-2,5-dicarboxylate is an agrochemical compound used primarily as an insect repellent. Its structure features a pyridine ring with two ester functional groups, contributing to its chemical properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 136-45-8
Dimethyl carbate
insect repellent
Urea, N-[2,6-bis(1-methylethyl)-4-phenoxyphenyl]-N'-(1,1-dimethylethyl)-
urea herbicide intermediate
3,5-dichloro-2,4,6-trifluorobenzoic acid
agrochemical intermediate
Thiram
Crop fungicide and seed protectant
ZIRAM
fungicide for vegetable diseases
dipropyl pyridine-2,5-dicarboxylate
IITCWRFYJWUUPC-UHFFFAOYSA-N
CCCOC(=O)C1=CN=C(C=C1)C(=O)OCCC