This compound is a synthetic intermediate characterized by a complex heterocyclic structure containing an aminopyrrolotriazine core and multiple benzyl ether protecting groups. It is primarily significant as a building block in the laboratory-scale synthesis of antiviral agents.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1355049-94-3
(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carbonitrile
Pharmaceutical intermediate for Remdesivir
Bis valacyclovir
Impurity standard for acyclovir
2-(((R)-2-Amino-2-(4-hydroxyphenyl)acetamido)methyl(-5,5-dimethylthiazolidine-4-carboxylic acid, (4S)-
pharmaceutical intermediate
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-[1-(triphenylmethyl)-1H-imidazol-4-yl]propanoic acid
Protected amino acid for peptide synthesis
Tert-butyl (piperidin-4-ylmethyl)carbamate
Boc-protected amine intermediate
(3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol
GFFNZQLCNVVBEE-HQRSTYDCSA-N
C1=CC=C(C=C1)COC[C@@H]2[C@H]([C@H](C(O2)(C3=CC=C4N3N=CN=C4N)O)OCC5=CC=CC=C5)OCC6=CC=CC=C6