Azido-PEG4-PFP ester is a research reagent featuring an azide group and a pentafluorophenyl ester moiety connected by a polyethylene glycol (PEG) spacer. It is primarily used in bioconjugation and PEGylation applications for laboratory research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1353012-00-6
Azido-PEG2-PFP ester
bioconjugation crosslinking reagent
11,12-Didehydro-gamma-oxodibenz[b,f]azocine-5(6H)-butanoic acid
click chemistry reagent
Dbco-nhs ester
Copper-free click chemistry reagent
2-Bromo-3-fluoro-5-nitropyridine
Research compound for organic synthesis
3,5-Diiodo-4-methylpyridin-2-amine
Research compound
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoate
QSIFGTAWLLFXPY-UHFFFAOYSA-N
C(COCCOCCOCCOCCN=[N+]=[N-])C(=O)OC1=C(C(=C(C(=C1F)F)F)F)F