Fmoc-L-norvaline is a protected amino acid derivative used in peptide synthesis, where the Fmoc (9-fluorenylmethoxycarbonyl) group shields the amino group during chain assembly. It serves as a building block for incorporating norvaline into custom peptide sequences in laboratory research and pharmaceutical manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 135112-28-6
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-methionine
Fmoc-protected amino acid for peptide synthesis
D-FMOC-methionine
Protected amino acid for peptide synthesis
Fmoc-beta-t-butyl-L-alanine
peptide synthesis building block
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
(1S)-1-(3-chlorophenyl)ethan-1-ol
Chiral building block for pharmaceuticals
3-(chloromethyl)-1-methyl-1H-1,2,4-triazole hydrochloride
pharmaceutical intermediate
(R)-2-Hydroxy-1-morpholinopropan-1-one
Pharmaceutical intermediate
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid
JBIJSEUVWWLFGV-SFHVURJKSA-N
CCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13