3-O-Methyl Colterol-d9 is a deuterium-labeled research compound, structurally characterized as an aromatic amine with alcohol and ether functional groups. Its primary significance lies in its use as an isotopically labeled standard for analytical and laboratory research applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1346599-83-4
N-(tert-Butoxycarbonyl)-L-alanine-1-13C
Isotopically labeled research compound
5-(4-HYDROXYPHENYL)-5-PHENYL-D5-HYDANTOIN-15N2
Isotopically labeled research compound
Methylamine-15N hydrochloride
Isotopically labeled research compound
9-beta-D-Ribofuranosyl-9H-purin-6-amine-15N
Isotopically labeled research compound
6-(Desmethyl)-7-methyl zolpidem
Reference standard for analytical testing
Hydroxymethyl Clenbuterol-d6
deuterium-labeled reference standard
Rac N-Benzyl-N-desmethyl Tramadol-d3
deuterated analytical reference standard
(+/-)-N-Desmethyl Trifluoroacetotramadol-d3
research compound
4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]-2-methoxyphenol
WVGNWNYBARIPKQ-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NCC(C1=CC(=C(C=C1)O)OC)O