4-Bromochlorobenzene-d4 is a deuterated reference standard compound, specifically the tetradeuterated analogue of 1-bromo-4-chlorobenzene where all four aromatic hydrogen atoms are replaced by deuterium. It is primarily used as an internal standard or labeled tracer in analytical chemistry, particularly for mass spectrometry and nuclear magnetic resonance spectroscopy.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 134415-42-2
(1R)-1-(3-chloro-4-fluorophenyl)ethan-1-ol
research compound
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
asymmetric hydrogenation catalyst
Gold triiodide
research compound
2,4-Diphenyl-6-(4,4,5,5-tetramethyl-[1,3,2] dioxaborolan-2-yl)-[1,3,5]triazine
research reagent
1-Bromo-4-chlorobenzene
Chemical intermediate for synthesis
1-bromo-4-chloro-2,3,5,6-tetradeuteriobenzene
NHDODQWIKUYWMW-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1Cl)[2H])[2H])Br)[2H]