1,2-dicervonoylglycerol is a long-chain diglyceride used as a research standard in lipid studies. Its structure features two docosahexaenoic acid chains esterified to a glycerol backbone, contributing to its high molecular weight and flexibility.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 133831-25-1
1,2,3,4-Tetrahydro-1,5-naphthyridine hydrochloride
research compound
2-Cyanoethyl (6-(2,2,2-trifluoroacetamido)hexyl) diisopropylphosphoramidite
solid-phase oligonucleotide synthesis reagent
2-oxaspiro[3.3]heptan-6-one
research reagent
BENZIL
organic synthesis reagent
[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-3-hydroxypropyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
XIAZEYRSKHAPND-GZSOIYOPSA-N
CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OCC(CO)OC(=O)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC