Fmoc-Glu(OAll)-OH is a research compound used in peptide synthesis, featuring a fluorenylmethoxycarbonyl (Fmoc) protecting group and an allyl ester side-chain protection. It is employed as a building block for the stepwise assembly of peptides, particularly where orthogonal deprotection strategies are required.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 133464-46-7
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-glutamic-acid-alpha allyl ester
Fmoc-protected amino acid derivative
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-6-{[(prop-2-en-1-yloxy)carbonyl]amino}hexanoic acid
Protected amino acid for peptide synthesis
Alloc-Lys(Fmoc)-OH
protected amino acid for peptide synthesis
Fmoc-L-aspartic acid
research compound for peptide synthesis
Fmoc-Gln(Trt)-Thr(Psi(Me,Me)pro)-OH
research compound for peptide synthesis
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)glycylglycylglycine
research compound for peptide synthesis
Fmoc-Gln(Trt)-Ser(Psi(Me,Me)pro)-OH
research compound for peptide synthesis
(1,10-Phenanthroline)(trifluoromethyl)(triphenylphosphine)copper(I)
copper catalyst for cross-coupling reactions
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid
LRBARFFNYOKIAX-FQEVSTJZSA-N
C=CCOC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13